C16H15ClN2O3S2 — CID 57411915
4-chloro-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-methylbenzenesulfonamide (PubChem CID 57411915) has the molecular formula C16H15ClN2O3S2 and a molecular weight of 382.89 g/mol. Its IUPAC name is 4-chloro-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-methylbenzenesulfonamide.
| Compound Name | 4-chloro-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 57411915 |
| Molecular Formula | C16H15ClN2O3S2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | 4-chloro-N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-methylbenzenesulfonamide |
| SMILES | CCOc1ccc2nc(NS(=O)(=O)c3ccc(Cl)c(C)c3)sc2c1 |
| InChI | InChI=1S/C16H15ClN2O3S2/c1-3-22-11-4-7-14-15(9-11)23-16(18-14)19-24(20,21)12-5-6-13(17)10(2)8-12/h4-9H,3H2,1-2H3,(H,18,19) |
| InChIKey | ZYLWBDAFVKRGSU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |