C15H11ClN2O4S2 — CID 39855236
2-chloro-5-[(6-methyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoic acid (PubChem CID 39855236) has the molecular formula C15H11ClN2O4S2 and a molecular weight of 382.85 g/mol. Its IUPAC name is 2-chloro-5-[(6-methyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoic acid.
| Compound Name | 2-chloro-5-[(6-methyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 39855236 |
| Molecular Formula | C15H11ClN2O4S2 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | 2-chloro-5-[(6-methyl-1,3-benzothiazol-2-yl)sulfamoyl]benzoic acid |
| SMILES | Cc1ccc2nc(NS(=O)(=O)c3ccc(Cl)c(C(=O)O)c3)sc2c1 |
| InChI | InChI=1S/C15H11ClN2O4S2/c1-8-2-5-12-13(6-8)23-15(17-12)18-24(21,22)9-3-4-11(16)10(7-9)14(19)20/h2-7H,1H3,(H,17,18)(H,19,20) |
| InChIKey | IEJDVDGDIRQPRK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |