C15H11N2O5S2- — CID 54694024
2-carboxy-4-[(6-methyl-1,3-benzothiazol-2-yl)sulfamoyl]phenolate (PubChem CID 54694024) has the molecular formula C15H11N2O5S2- and a molecular weight of 363.40 g/mol. Its IUPAC name is 2-carboxy-4-[(6-methyl-1,3-benzothiazol-2-yl)sulfamoyl]phenolate.
| Compound Name | 2-carboxy-4-[(6-methyl-1,3-benzothiazol-2-yl)sulfamoyl]phenolate |
|---|---|
| PubChem CID | 54694024 |
| Molecular Formula | C15H11N2O5S2- |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 2-carboxy-4-[(6-methyl-1,3-benzothiazol-2-yl)sulfamoyl]phenolate |
| SMILES | Cc1ccc2nc(NS(=O)(=O)c3ccc([O-])c(C(=O)O)c3)sc2c1 |
| InChI | InChI=1S/C15H12N2O5S2/c1-8-2-4-11-13(6-8)23-15(16-11)17-24(21,22)9-3-5-12(18)10(7-9)14(19)20/h2-7,18H,1H3,(H,16,17)(H,19,20)/p-1 |
| InChIKey | PZXSZHMGGGYHSN-UHFFFAOYSA-M |
| XLogP | 2.18 |
| TPSA | 119.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |