About 2-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)-1H-imidazole-5-sulfonamide
2-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)-1H-imidazole-5-sulfonamide (PubChem CID 63000149) has the molecular formula C12H12N4O2S2
and a molecular weight of 308.39 g/mol. Its IUPAC name is 2-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)-1H-imidazole-5-sulfonamide.
Molecular Properties
| Compound Name | 2-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)-1H-imidazole-5-sulfonamide |
| PubChem CID | 63000149 |
| Molecular Formula | C12H12N4O2S2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 2-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)-1H-imidazole-5-sulfonamide |
| SMILES | Cc1ccc2nc(NS(=O)(=O)c3cnc(C)[nH]3)sc2c1 |
| InChI | InChI=1S/C12H12N4O2S2/c1-7-3-4-9-10(5-7)19-12(15-9)16-20(17,18)11-6-13-8(2)14-11/h3-6H,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | GKLBZEQAALQOTE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)-1H-imidazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)-1H-imidazole-5-sulfonamide?
The IUPAC name of 2-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)-1H-imidazole-5-sulfonamide (CID 63000149) is 2-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)-1H-imidazole-5-sulfonamide.
What is the SMILES notation for 2-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)-1H-imidazole-5-sulfonamide?
The canonical SMILES for 2-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)-1H-imidazole-5-sulfonamide is Cc1ccc2nc(NS(=O)(=O)c3cnc(C)[nH]3)sc2c1.
What is the InChIKey of 2-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)-1H-imidazole-5-sulfonamide?
The InChIKey is GKLBZEQAALQOTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O2S2/c1-7-3-4-9-10(5-7)19-12(15-9)16-20(17,18)11-6-13-8(2)14-11/h3-6H,1-2H3,(H,13,14)(H,15,16).
What are the key properties of 2-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)-1H-imidazole-5-sulfonamide?
2-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)-1H-imidazole-5-sulfonamide has a molecular weight of 308.39 g/mol, XLogP of 2.44, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-(6-methyl-1,3-benzothiazol-2-yl)-1H-imidazole-5-sulfonamide is sourced from PubChem (CID 63000149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).