C13H18N2O4S2 — CID 110676125
2-(2-methoxyethoxy)-N-(6-methyl-1,3-benzothiazol-2-yl)ethanesulfonamide (PubChem CID 110676125) has the molecular formula C13H18N2O4S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N-(6-methyl-1,3-benzothiazol-2-yl)ethanesulfonamide.
| Compound Name | 2-(2-methoxyethoxy)-N-(6-methyl-1,3-benzothiazol-2-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 110676125 |
| Molecular Formula | C13H18N2O4S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 2-(2-methoxyethoxy)-N-(6-methyl-1,3-benzothiazol-2-yl)ethanesulfonamide |
| SMILES | COCCOCCS(=O)(=O)Nc1nc2ccc(C)cc2s1 |
| InChI | InChI=1S/C13H18N2O4S2/c1-10-3-4-11-12(9-10)20-13(14-11)15-21(16,17)8-7-19-6-5-18-2/h3-4,9H,5-8H2,1-2H3,(H,14,15) |
| InChIKey | UEGDGUADFIQXNT-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|