C12H16N2O3S2 — CID 60640590
N-(6-ethoxy-1,3-benzothiazol-2-yl)propane-1-sulfonamide (PubChem CID 60640590) has the molecular formula C12H16N2O3S2 and a molecular weight of 300.41 g/mol. Its IUPAC name is N-(6-ethoxy-1,3-benzothiazol-2-yl)propane-1-sulfonamide.
| Compound Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 60640590 |
| Molecular Formula | C12H16N2O3S2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)Nc1nc2ccc(OCC)cc2s1 |
| InChI | InChI=1S/C12H16N2O3S2/c1-3-7-19(15,16)14-12-13-10-6-5-9(17-4-2)8-11(10)18-12/h5-6,8H,3-4,7H2,1-2H3,(H,13,14) |
| InChIKey | SQGKUOAQLFKTTF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |