C13H17N3O3S2 — CID 43101771
2-amino-N-(6-methyl-1,3-benzothiazol-2-yl)-4-methylsulfonylbutanamide (PubChem CID 43101771) has the molecular formula C13H17N3O3S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-amino-N-(6-methyl-1,3-benzothiazol-2-yl)-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-(6-methyl-1,3-benzothiazol-2-yl)-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 43101771 |
| Molecular Formula | C13H17N3O3S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 2-amino-N-(6-methyl-1,3-benzothiazol-2-yl)-4-methylsulfonylbutanamide |
| SMILES | Cc1ccc2nc(NC(=O)C(N)CCS(C)(=O)=O)sc2c1 |
| InChI | InChI=1S/C13H17N3O3S2/c1-8-3-4-10-11(7-8)20-13(15-10)16-12(17)9(14)5-6-21(2,18)19/h3-4,7,9H,5-6,14H2,1-2H3,(H,15,16,17) |
| InChIKey | NIRMIXVWXAHCNQ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |