C11H13N3O3S2 — CID 61024285
N-(6-amino-1,3-benzothiazol-2-yl)-2-methylsulfonylpropanamide (PubChem CID 61024285) has the molecular formula C11H13N3O3S2 and a molecular weight of 299.38 g/mol. Its IUPAC name is N-(6-amino-1,3-benzothiazol-2-yl)-2-methylsulfonylpropanamide.
| Compound Name | N-(6-amino-1,3-benzothiazol-2-yl)-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 61024285 |
| Molecular Formula | C11H13N3O3S2 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | N-(6-amino-1,3-benzothiazol-2-yl)-2-methylsulfonylpropanamide |
| SMILES | CC(C(=O)Nc1nc2ccc(N)cc2s1)S(C)(=O)=O |
| InChI | InChI=1S/C11H13N3O3S2/c1-6(19(2,16)17)10(15)14-11-13-8-4-3-7(12)5-9(8)18-11/h3-6H,12H2,1-2H3,(H,13,14,15) |
| InChIKey | VYAUJPSNEPSSCQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|