C15H21N3OS2 — CID 107749094
N-(6-amino-1,3-benzothiazol-2-yl)-2-(3-methylbutylsulfanyl)propanamide (PubChem CID 107749094) has the molecular formula C15H21N3OS2 and a molecular weight of 323.49 g/mol. Its IUPAC name is N-(6-amino-1,3-benzothiazol-2-yl)-2-(3-methylbutylsulfanyl)propanamide.
| Compound Name | N-(6-amino-1,3-benzothiazol-2-yl)-2-(3-methylbutylsulfanyl)propanamide |
|---|---|
| PubChem CID | 107749094 |
| Molecular Formula | C15H21N3OS2 |
| Molecular Weight | 323.49 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | N-(6-amino-1,3-benzothiazol-2-yl)-2-(3-methylbutylsulfanyl)propanamide |
| SMILES | CC(C)CCSC(C)C(=O)Nc1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C15H21N3OS2/c1-9(2)6-7-20-10(3)14(19)18-15-17-12-5-4-11(16)8-13(12)21-15/h4-5,8-10H,6-7,16H2,1-3H3,(H,17,18,19) |
| InChIKey | WOVFABZODMDRPD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|