C13H19N3S — CID 55175156
2-N-(4-methylpentyl)-1,3-benzothiazole-2,6-diamine (PubChem CID 55175156) has the molecular formula C13H19N3S and a molecular weight of 249.38 g/mol. Its IUPAC name is 2-N-(4-methylpentyl)-1,3-benzothiazole-2,6-diamine.
| Compound Name | 2-N-(4-methylpentyl)-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 55175156 |
| Molecular Formula | C13H19N3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 2-N-(4-methylpentyl)-1,3-benzothiazole-2,6-diamine |
| SMILES | CC(C)CCCNc1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C13H19N3S/c1-9(2)4-3-7-15-13-16-11-6-5-10(14)8-12(11)17-13/h5-6,8-9H,3-4,7,14H2,1-2H3,(H,15,16) |
| InChIKey | YWAPVPDOLCIFAK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|