C11H15N3S2 — CID 63983124
2-N-(3-methylsulfanylpropyl)-1,3-benzothiazole-2,6-diamine (PubChem CID 63983124) has the molecular formula C11H15N3S2 and a molecular weight of 253.40 g/mol. Its IUPAC name is 2-N-(3-methylsulfanylpropyl)-1,3-benzothiazole-2,6-diamine.
| Compound Name | 2-N-(3-methylsulfanylpropyl)-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 63983124 |
| Molecular Formula | C11H15N3S2 |
| Molecular Weight | 253.40 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-N-(3-methylsulfanylpropyl)-1,3-benzothiazole-2,6-diamine |
| SMILES | CSCCCNc1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C11H15N3S2/c1-15-6-2-5-13-11-14-9-4-3-8(12)7-10(9)16-11/h3-4,7H,2,5-6,12H2,1H3,(H,13,14) |
| InChIKey | MCBZKCYFJOLTIX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|