C15H13F2N3S — CID 63231503
2-N-[2-(3,5-difluorophenyl)ethyl]-1,3-benzothiazole-2,6-diamine (PubChem CID 63231503) has the molecular formula C15H13F2N3S and a molecular weight of 305.35 g/mol. Its IUPAC name is 2-N-[2-(3,5-difluorophenyl)ethyl]-1,3-benzothiazole-2,6-diamine.
| Compound Name | 2-N-[2-(3,5-difluorophenyl)ethyl]-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 63231503 |
| Molecular Formula | C15H13F2N3S |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 2-N-[2-(3,5-difluorophenyl)ethyl]-1,3-benzothiazole-2,6-diamine |
| SMILES | Nc1ccc2nc(NCCc3cc(F)cc(F)c3)sc2c1 |
| InChI | InChI=1S/C15H13F2N3S/c16-10-5-9(6-11(17)7-10)3-4-19-15-20-13-2-1-12(18)8-14(13)21-15/h1-2,5-8H,3-4,18H2,(H,19,20) |
| InChIKey | FOGLOJLOIFMVFS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|