C13H19N3OS — CID 82940537
2-N-(3-propoxypropyl)-1,3-benzothiazole-2,6-diamine (PubChem CID 82940537) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is 2-N-(3-propoxypropyl)-1,3-benzothiazole-2,6-diamine.
| Compound Name | 2-N-(3-propoxypropyl)-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 82940537 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-N-(3-propoxypropyl)-1,3-benzothiazole-2,6-diamine |
| SMILES | CCCOCCCNc1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C13H19N3OS/c1-2-7-17-8-3-6-15-13-16-11-5-4-10(14)9-12(11)18-13/h4-5,9H,2-3,6-8,14H2,1H3,(H,15,16) |
| InChIKey | MLAZGHFBAYGXMB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|