C13H20N4S — CID 63231257
2-N-[2-(dimethylamino)-2-methylpropyl]-1,3-benzothiazole-2,6-diamine (PubChem CID 63231257) has the molecular formula C13H20N4S and a molecular weight of 264.40 g/mol. Its IUPAC name is 2-N-[2-(dimethylamino)-2-methylpropyl]-1,3-benzothiazole-2,6-diamine.
| Compound Name | 2-N-[2-(dimethylamino)-2-methylpropyl]-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 63231257 |
| Molecular Formula | C13H20N4S |
| Molecular Weight | 264.40 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-N-[2-(dimethylamino)-2-methylpropyl]-1,3-benzothiazole-2,6-diamine |
| SMILES | CN(C)C(C)(C)CNc1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C13H20N4S/c1-13(2,17(3)4)8-15-12-16-10-6-5-9(14)7-11(10)18-12/h5-7H,8,14H2,1-4H3,(H,15,16) |
| InChIKey | WRBVFBXIOSXRHF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|