C12H16N4OS — CID 28785701
1-(6-amino-1,3-benzothiazol-2-yl)-3-tert-butylurea (PubChem CID 28785701) has the molecular formula C12H16N4OS and a molecular weight of 264.35 g/mol. Its IUPAC name is 1-(6-amino-1,3-benzothiazol-2-yl)-3-tert-butylurea.
| Compound Name | 1-(6-amino-1,3-benzothiazol-2-yl)-3-tert-butylurea |
|---|---|
| PubChem CID | 28785701 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 1-(6-amino-1,3-benzothiazol-2-yl)-3-tert-butylurea |
| SMILES | CC(C)(C)NC(=O)Nc1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C12H16N4OS/c1-12(2,3)16-10(17)15-11-14-8-5-4-7(13)6-9(8)18-11/h4-6H,13H2,1-3H3,(H2,14,15,16,17) |
| InChIKey | PCCBSSUDOYQSSF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|