C9H9N3O2S — CID 43165023
N-(6-amino-1,3-benzothiazol-2-yl)-2-hydroxyacetamide (PubChem CID 43165023) has the molecular formula C9H9N3O2S and a molecular weight of 223.26 g/mol. Its IUPAC name is N-(6-amino-1,3-benzothiazol-2-yl)-2-hydroxyacetamide.
| Compound Name | N-(6-amino-1,3-benzothiazol-2-yl)-2-hydroxyacetamide |
|---|---|
| PubChem CID | 43165023 |
| Molecular Formula | C9H9N3O2S |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | N-(6-amino-1,3-benzothiazol-2-yl)-2-hydroxyacetamide |
| SMILES | Nc1ccc2nc(NC(=O)CO)sc2c1 |
| InChI | InChI=1S/C9H9N3O2S/c10-5-1-2-6-7(3-5)15-9(11-6)12-8(14)4-13/h1-3,13H,4,10H2,(H,11,12,14) |
| InChIKey | SBFLEYZYXXJTRD-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|