C10H11N3O2S — CID 43164972
N-(6-amino-1,3-benzothiazol-2-yl)-2-hydroxypropanamide (PubChem CID 43164972) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is N-(6-amino-1,3-benzothiazol-2-yl)-2-hydroxypropanamide.
| Compound Name | N-(6-amino-1,3-benzothiazol-2-yl)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 43164972 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | N-(6-amino-1,3-benzothiazol-2-yl)-2-hydroxypropanamide |
| SMILES | CC(O)C(=O)Nc1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C10H11N3O2S/c1-5(14)9(15)13-10-12-7-3-2-6(11)4-8(7)16-10/h2-5,14H,11H2,1H3,(H,12,13,15) |
| InChIKey | LLBBVLXURLPNJG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|