C15H22N4OS — CID 43272521
N-(6-amino-1,3-benzothiazol-2-yl)-2-[butan-2-yl(methyl)amino]propanamide (PubChem CID 43272521) has the molecular formula C15H22N4OS and a molecular weight of 306.44 g/mol. Its IUPAC name is N-(6-amino-1,3-benzothiazol-2-yl)-2-[butan-2-yl(methyl)amino]propanamide.
| Compound Name | N-(6-amino-1,3-benzothiazol-2-yl)-2-[butan-2-yl(methyl)amino]propanamide |
|---|---|
| PubChem CID | 43272521 |
| Molecular Formula | C15H22N4OS |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | N-(6-amino-1,3-benzothiazol-2-yl)-2-[butan-2-yl(methyl)amino]propanamide |
| SMILES | CCC(C)N(C)C(C)C(=O)Nc1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C15H22N4OS/c1-5-9(2)19(4)10(3)14(20)18-15-17-12-7-6-11(16)8-13(12)21-15/h6-10H,5,16H2,1-4H3,(H,17,18,20) |
| InChIKey | RJEARUNKUVSZAN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|