C12H13FN2OS — CID 24625327
N-(6-fluoro-1,3-benzothiazol-2-yl)-2-methylbutanamide (PubChem CID 24625327) has the molecular formula C12H13FN2OS and a molecular weight of 252.31 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-2-methylbutanamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-2-methylbutanamide |
|---|---|
| PubChem CID | 24625327 |
| Molecular Formula | C12H13FN2OS |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-2-methylbutanamide |
| SMILES | CCC(C)C(=O)Nc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C12H13FN2OS/c1-3-7(2)11(16)15-12-14-9-5-4-8(13)6-10(9)17-12/h4-7H,3H2,1-2H3,(H,14,15,16) |
| InChIKey | MLPNDWHYSBZLRS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |