C12H15FN2S — CID 79143974
6-fluoro-N-(2-methylbutyl)-1,3-benzothiazol-2-amine (PubChem CID 79143974) has the molecular formula C12H15FN2S and a molecular weight of 238.33 g/mol. Its IUPAC name is 6-fluoro-N-(2-methylbutyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-fluoro-N-(2-methylbutyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 79143974 |
| Molecular Formula | C12H15FN2S |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 6-fluoro-N-(2-methylbutyl)-1,3-benzothiazol-2-amine |
| SMILES | CCC(C)CNc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C12H15FN2S/c1-3-8(2)7-14-12-15-10-5-4-9(13)6-11(10)16-12/h4-6,8H,3,7H2,1-2H3,(H,14,15) |
| InChIKey | DCWVERYBZOTGAO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |