C10H12FN3S — CID 82191684
N'-(6-fluoro-1,3-benzothiazol-2-yl)propane-1,3-diamine (PubChem CID 82191684) has the molecular formula C10H12FN3S and a molecular weight of 225.29 g/mol. Its IUPAC name is N'-(6-fluoro-1,3-benzothiazol-2-yl)propane-1,3-diamine.
| Compound Name | N'-(6-fluoro-1,3-benzothiazol-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 82191684 |
| Molecular Formula | C10H12FN3S |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | N'-(6-fluoro-1,3-benzothiazol-2-yl)propane-1,3-diamine |
| SMILES | NCCCNc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C10H12FN3S/c11-7-2-3-8-9(6-7)15-10(14-8)13-5-1-4-12/h2-3,6H,1,4-5,12H2,(H,13,14) |
| InChIKey | SGOFYBBWWHCYBU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|