C10H10FN3O2S — CID 83204723
2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]ethyl carbamate (PubChem CID 83204723) has the molecular formula C10H10FN3O2S and a molecular weight of 255.27 g/mol. Its IUPAC name is 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]ethyl carbamate.
| Compound Name | 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 83204723 |
| Molecular Formula | C10H10FN3O2S |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]ethyl carbamate |
| SMILES | NC(=O)OCCNc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C10H10FN3O2S/c11-6-1-2-7-8(5-6)17-10(14-7)13-3-4-16-9(12)15/h1-2,5H,3-4H2,(H2,12,15)(H,13,14) |
| InChIKey | CGDKUBXCQFMPPU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|