C11H13FN2OS2 — CID 113487886
6-fluoro-N-(3-methylsulfinylpropyl)-1,3-benzothiazol-2-amine (PubChem CID 113487886) has the molecular formula C11H13FN2OS2 and a molecular weight of 272.37 g/mol. Its IUPAC name is 6-fluoro-N-(3-methylsulfinylpropyl)-1,3-benzothiazol-2-amine.
| Compound Name | 6-fluoro-N-(3-methylsulfinylpropyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 113487886 |
| Molecular Formula | C11H13FN2OS2 |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 6-fluoro-N-(3-methylsulfinylpropyl)-1,3-benzothiazol-2-amine |
| SMILES | CS(=O)CCCNc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C11H13FN2OS2/c1-17(15)6-2-5-13-11-14-9-4-3-8(12)7-10(9)16-11/h3-4,7H,2,5-6H2,1H3,(H,13,14) |
| InChIKey | ZWXMMQBZMRVLSB-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|