C14H20FN3S — CID 79143470
N',N'-diethyl-N-(6-fluoro-1,3-benzothiazol-2-yl)propane-1,3-diamine (PubChem CID 79143470) has the molecular formula C14H20FN3S and a molecular weight of 281.40 g/mol. Its IUPAC name is N',N'-diethyl-N-(6-fluoro-1,3-benzothiazol-2-yl)propane-1,3-diamine.
| Compound Name | N',N'-diethyl-N-(6-fluoro-1,3-benzothiazol-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 79143470 |
| Molecular Formula | C14H20FN3S |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N',N'-diethyl-N-(6-fluoro-1,3-benzothiazol-2-yl)propane-1,3-diamine |
| SMILES | CCN(CC)CCCNc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C14H20FN3S/c1-3-18(4-2)9-5-8-16-14-17-12-7-6-11(15)10-13(12)19-14/h6-7,10H,3-5,8-9H2,1-2H3,(H,16,17) |
| InChIKey | YHHNXGOQTPXSMG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|