C14H23Cl2N3OS — CID 14749896
2-[3-(diethylamino)propylamino]-1,3-benzothiazol-6-ol;dihydrochloride (PubChem CID 14749896) has the molecular formula C14H23Cl2N3OS and a molecular weight of 352.33 g/mol. Its IUPAC name is 2-[3-(diethylamino)propylamino]-1,3-benzothiazol-6-ol;dihydrochloride.
| Compound Name | 2-[3-(diethylamino)propylamino]-1,3-benzothiazol-6-ol;dihydrochloride |
|---|---|
| PubChem CID | 14749896 |
| Molecular Formula | C14H23Cl2N3OS |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 2-[3-(diethylamino)propylamino]-1,3-benzothiazol-6-ol;dihydrochloride |
| SMILES | CCN(CC)CCCNc1nc2ccc(O)cc2s1.Cl.Cl |
| InChI | InChI=1S/C14H21N3OS.2ClH/c1-3-17(4-2)9-5-8-15-14-16-12-7-6-11(18)10-13(12)19-14;;/h6-7,10,18H,3-5,8-9H2,1-2H3,(H,15,16);2*1H |
| InChIKey | SAUSYPJWKAUPBP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|