C10H12N2O2S — CID 146453884
2-(3-hydroxypropylamino)-1,3-benzothiazol-6-ol (PubChem CID 146453884) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-(3-hydroxypropylamino)-1,3-benzothiazol-6-ol.
| Compound Name | 2-(3-hydroxypropylamino)-1,3-benzothiazol-6-ol |
|---|---|
| PubChem CID | 146453884 |
| Molecular Formula | C10H12N2O2S |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 2-(3-hydroxypropylamino)-1,3-benzothiazol-6-ol |
| SMILES | OCCCNc1nc2ccc(O)cc2s1 |
| InChI | InChI=1S/C10H12N2O2S/c13-5-1-4-11-10-12-8-3-2-7(14)6-9(8)15-10/h2-3,6,13-14H,1,4-5H2,(H,11,12) |
| InChIKey | ZIHSKORCCBDAHR-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|