C7H4FNOS — CID 91882966
2-fluoro-1,3-benzothiazol-6-ol (PubChem CID 91882966) has the molecular formula C7H4FNOS and a molecular weight of 169.18 g/mol. Its IUPAC name is 2-fluoro-1,3-benzothiazol-6-ol.
| Compound Name | 2-fluoro-1,3-benzothiazol-6-ol |
|---|---|
| PubChem CID | 91882966 |
| Molecular Formula | C7H4FNOS |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.00 |
| IUPAC Name | 2-fluoro-1,3-benzothiazol-6-ol |
| SMILES | Oc1ccc2nc(F)sc2c1 |
| InChI | InChI=1S/C7H4FNOS/c8-7-9-5-2-1-4(10)3-6(5)11-7/h1-3,10H |
| InChIKey | YVTCLYGOXAVXBM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |