C9H8N2O3S — CID 135336697
(6-hydroxy-1,3-benzothiazol-2-yl)methyl carbamate (PubChem CID 135336697) has the molecular formula C9H8N2O3S and a molecular weight of 224.24 g/mol. Its IUPAC name is (6-hydroxy-1,3-benzothiazol-2-yl)methyl carbamate.
| Compound Name | (6-hydroxy-1,3-benzothiazol-2-yl)methyl carbamate |
|---|---|
| PubChem CID | 135336697 |
| Molecular Formula | C9H8N2O3S |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | (6-hydroxy-1,3-benzothiazol-2-yl)methyl carbamate |
| SMILES | NC(=O)OCc1nc2ccc(O)cc2s1 |
| InChI | InChI=1S/C9H8N2O3S/c10-9(13)14-4-8-11-6-2-1-5(12)3-7(6)15-8/h1-3,12H,4H2,(H2,10,13) |
| InChIKey | FAUOJQYCHYCVAG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |