C8H6N2O3S — CID 87123446
(6-hydroxy-1,3-benzothiazol-2-yl)carbamic acid (PubChem CID 87123446) has the molecular formula C8H6N2O3S and a molecular weight of 210.21 g/mol. Its IUPAC name is (6-hydroxy-1,3-benzothiazol-2-yl)carbamic acid.
| Compound Name | (6-hydroxy-1,3-benzothiazol-2-yl)carbamic acid |
|---|---|
| PubChem CID | 87123446 |
| Molecular Formula | C8H6N2O3S |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | (6-hydroxy-1,3-benzothiazol-2-yl)carbamic acid |
| SMILES | O=C(O)Nc1nc2ccc(O)cc2s1 |
| InChI | InChI=1S/C8H6N2O3S/c11-4-1-2-5-6(3-4)14-7(9-5)10-8(12)13/h1-3,11H,(H,9,10)(H,12,13) |
| InChIKey | POZGLEDLBCPBGE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |