C9H7N3O3S — CID 65348728
2-(carbamoylamino)-1,3-benzothiazole-6-carboxylic acid (PubChem CID 65348728) has the molecular formula C9H7N3O3S and a molecular weight of 237.24 g/mol. Its IUPAC name is 2-(carbamoylamino)-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-(carbamoylamino)-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 65348728 |
| Molecular Formula | C9H7N3O3S |
| Molecular Weight | 237.24 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 2-(carbamoylamino)-1,3-benzothiazole-6-carboxylic acid |
| SMILES | NC(=O)Nc1nc2ccc(C(=O)O)cc2s1 |
| InChI | InChI=1S/C9H7N3O3S/c10-8(15)12-9-11-5-2-1-4(7(13)14)3-6(5)16-9/h1-3H,(H,13,14)(H3,10,11,12,15) |
| InChIKey | ANYTXXLWUTUSLT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |