C13H8N2O4S — CID 65348957
2-(furan-3-carbonylamino)-1,3-benzothiazole-6-carboxylic acid (PubChem CID 65348957) has the molecular formula C13H8N2O4S and a molecular weight of 288.28 g/mol. Its IUPAC name is 2-(furan-3-carbonylamino)-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-(furan-3-carbonylamino)-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 65348957 |
| Molecular Formula | C13H8N2O4S |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 2-(furan-3-carbonylamino)-1,3-benzothiazole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(NC(=O)c3ccoc3)sc2c1 |
| InChI | InChI=1S/C13H8N2O4S/c16-11(8-3-4-19-6-8)15-13-14-9-2-1-7(12(17)18)5-10(9)20-13/h1-6H,(H,17,18)(H,14,15,16) |
| InChIKey | PMBKKAZPBOGHKZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |