C14H16N2O3S — CID 65348581
2-(2,3-dimethylbutanoylamino)-1,3-benzothiazole-6-carboxylic acid (PubChem CID 65348581) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is 2-(2,3-dimethylbutanoylamino)-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-(2,3-dimethylbutanoylamino)-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 65348581 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-(2,3-dimethylbutanoylamino)-1,3-benzothiazole-6-carboxylic acid |
| SMILES | CC(C)C(C)C(=O)Nc1nc2ccc(C(=O)O)cc2s1 |
| InChI | InChI=1S/C14H16N2O3S/c1-7(2)8(3)12(17)16-14-15-10-5-4-9(13(18)19)6-11(10)20-14/h4-8H,1-3H3,(H,18,19)(H,15,16,17) |
| InChIKey | SHCLUOOAKCQKEU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |