C13H12N2O4S — CID 104855773
2-[[(2S)-oxolane-2-carbonyl]amino]-1,3-benzothiazole-6-carboxylic acid (PubChem CID 104855773) has the molecular formula C13H12N2O4S and a molecular weight of 292.32 g/mol. Its IUPAC name is 2-[[(2S)-oxolane-2-carbonyl]amino]-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-[[(2S)-oxolane-2-carbonyl]amino]-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 104855773 |
| Molecular Formula | C13H12N2O4S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 2-[[(2S)-oxolane-2-carbonyl]amino]-1,3-benzothiazole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(NC(=O)[C@@H]3CCCO3)sc2c1 |
| InChI | InChI=1S/C13H12N2O4S/c16-11(9-2-1-5-19-9)15-13-14-8-4-3-7(12(17)18)6-10(8)20-13/h3-4,6,9H,1-2,5H2,(H,17,18)(H,14,15,16)/t9-/m0/s1 |
| InChIKey | UKJPJCXNRZGANA-VIFPVBQESA-N |
| XLogP | 2.11 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |