C18H16N4O3S — CID 175055623
N-[2-(oxolane-2-carbonylamino)-1,3-benzothiazol-6-yl]pyridine-3-carboxamide (PubChem CID 175055623) has the molecular formula C18H16N4O3S and a molecular weight of 368.42 g/mol. Its IUPAC name is N-[2-(oxolane-2-carbonylamino)-1,3-benzothiazol-6-yl]pyridine-3-carboxamide.
| Compound Name | N-[2-(oxolane-2-carbonylamino)-1,3-benzothiazol-6-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175055623 |
| Molecular Formula | C18H16N4O3S |
| Molecular Weight | 368.42 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | N-[2-(oxolane-2-carbonylamino)-1,3-benzothiazol-6-yl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc2nc(NC(=O)C3CCCO3)sc2c1)c1cccnc1 |
| InChI | InChI=1S/C18H16N4O3S/c23-16(11-3-1-7-19-10-11)20-12-5-6-13-15(9-12)26-18(21-13)22-17(24)14-4-2-8-25-14/h1,3,5-7,9-10,14H,2,4,8H2,(H,20,23)(H,21,22,24) |
| InChIKey | QNJGFMMROOYROI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |