C12H13N3O4S2 — CID 734498
(2R)-N-(6-sulfamoyl-1,3-benzothiazol-2-yl)oxolane-2-carboxamide (PubChem CID 734498) has the molecular formula C12H13N3O4S2 and a molecular weight of 327.39 g/mol. Its IUPAC name is (2R)-N-(6-sulfamoyl-1,3-benzothiazol-2-yl)oxolane-2-carboxamide.
| Compound Name | (2R)-N-(6-sulfamoyl-1,3-benzothiazol-2-yl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 734498 |
| Molecular Formula | C12H13N3O4S2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | (2R)-N-(6-sulfamoyl-1,3-benzothiazol-2-yl)oxolane-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc2nc(NC(=O)[C@H]3CCCO3)sc2c1 |
| InChI | InChI=1S/C12H13N3O4S2/c13-21(17,18)7-3-4-8-10(6-7)20-12(14-8)15-11(16)9-2-1-5-19-9/h3-4,6,9H,1-2,5H2,(H2,13,17,18)(H,14,15,16)/t9-/m1/s1 |
| InChIKey | GBFDRMLWKKFWNA-SECBINFHSA-N |
| XLogP | 1.06 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |