C12H13N3O3S — CID 62799366
N-(6-amino-1,3-benzothiazol-2-yl)-1,4-dioxane-2-carboxamide (PubChem CID 62799366) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is N-(6-amino-1,3-benzothiazol-2-yl)-1,4-dioxane-2-carboxamide.
| Compound Name | N-(6-amino-1,3-benzothiazol-2-yl)-1,4-dioxane-2-carboxamide |
|---|---|
| PubChem CID | 62799366 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | N-(6-amino-1,3-benzothiazol-2-yl)-1,4-dioxane-2-carboxamide |
| SMILES | Nc1ccc2nc(NC(=O)C3COCCO3)sc2c1 |
| InChI | InChI=1S/C12H13N3O3S/c13-7-1-2-8-10(5-7)19-12(14-8)15-11(16)9-6-17-3-4-18-9/h1-2,5,9H,3-4,6,13H2,(H,14,15,16) |
| InChIKey | CAJGXHYCECHQPL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|