C14H9Cl2N3OS — CID 29302670
N-(6-amino-1,3-benzothiazol-2-yl)-3,5-dichlorobenzamide (PubChem CID 29302670) has the molecular formula C14H9Cl2N3OS and a molecular weight of 338.22 g/mol. Its IUPAC name is N-(6-amino-1,3-benzothiazol-2-yl)-3,5-dichlorobenzamide.
| Compound Name | N-(6-amino-1,3-benzothiazol-2-yl)-3,5-dichlorobenzamide |
|---|---|
| PubChem CID | 29302670 |
| Molecular Formula | C14H9Cl2N3OS |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | N-(6-amino-1,3-benzothiazol-2-yl)-3,5-dichlorobenzamide |
| SMILES | Nc1ccc2nc(NC(=O)c3cc(Cl)cc(Cl)c3)sc2c1 |
| InChI | InChI=1S/C14H9Cl2N3OS/c15-8-3-7(4-9(16)5-8)13(20)19-14-18-11-2-1-10(17)6-12(11)21-14/h1-6H,17H2,(H,18,19,20) |
| InChIKey | ICZLNSBQJDSDMG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|