C10H7N5OS2 — CID 65214484
N-(6-amino-1,3-benzothiazol-2-yl)thiadiazole-4-carboxamide (PubChem CID 65214484) has the molecular formula C10H7N5OS2 and a molecular weight of 277.33 g/mol. Its IUPAC name is N-(6-amino-1,3-benzothiazol-2-yl)thiadiazole-4-carboxamide.
| Compound Name | N-(6-amino-1,3-benzothiazol-2-yl)thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 65214484 |
| Molecular Formula | C10H7N5OS2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | N-(6-amino-1,3-benzothiazol-2-yl)thiadiazole-4-carboxamide |
| SMILES | Nc1ccc2nc(NC(=O)c3csnn3)sc2c1 |
| InChI | InChI=1S/C10H7N5OS2/c11-5-1-2-6-8(3-5)18-10(12-6)13-9(16)7-4-17-15-14-7/h1-4H,11H2,(H,12,13,16) |
| InChIKey | AZCSPHRDGIIFOE-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|