C12H9N3OS2 — CID 16781152
N-(6-amino-1,3-benzothiazol-2-yl)thiophene-3-carboxamide (PubChem CID 16781152) has the molecular formula C12H9N3OS2 and a molecular weight of 275.36 g/mol. Its IUPAC name is N-(6-amino-1,3-benzothiazol-2-yl)thiophene-3-carboxamide.
| Compound Name | N-(6-amino-1,3-benzothiazol-2-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 16781152 |
| Molecular Formula | C12H9N3OS2 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | N-(6-amino-1,3-benzothiazol-2-yl)thiophene-3-carboxamide |
| SMILES | Nc1ccc2nc(NC(=O)c3ccsc3)sc2c1 |
| InChI | InChI=1S/C12H9N3OS2/c13-8-1-2-9-10(5-8)18-12(14-9)15-11(16)7-3-4-17-6-7/h1-6H,13H2,(H,14,15,16) |
| InChIKey | ISYNTYJXKPTKMX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|