C13H11N3OS2 — CID 24692699
N-(6-amino-1,3-benzothiazol-2-yl)-3-methylthiophene-2-carboxamide (PubChem CID 24692699) has the molecular formula C13H11N3OS2 and a molecular weight of 289.39 g/mol. Its IUPAC name is N-(6-amino-1,3-benzothiazol-2-yl)-3-methylthiophene-2-carboxamide.
| Compound Name | N-(6-amino-1,3-benzothiazol-2-yl)-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 24692699 |
| Molecular Formula | C13H11N3OS2 |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | N-(6-amino-1,3-benzothiazol-2-yl)-3-methylthiophene-2-carboxamide |
| SMILES | Cc1ccsc1C(=O)Nc1nc2ccc(N)cc2s1 |
| InChI | InChI=1S/C13H11N3OS2/c1-7-4-5-18-11(7)12(17)16-13-15-9-3-2-8(14)6-10(9)19-13/h2-6H,14H2,1H3,(H,15,16,17) |
| InChIKey | WYQOEQJGGLJPFH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|