C14H13N3OS2 — CID 65237523
N-(6-amino-1,3-benzothiazol-2-yl)-4,5-dimethylthiophene-2-carboxamide (PubChem CID 65237523) has the molecular formula C14H13N3OS2 and a molecular weight of 303.41 g/mol. Its IUPAC name is N-(6-amino-1,3-benzothiazol-2-yl)-4,5-dimethylthiophene-2-carboxamide.
| Compound Name | N-(6-amino-1,3-benzothiazol-2-yl)-4,5-dimethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 65237523 |
| Molecular Formula | C14H13N3OS2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | N-(6-amino-1,3-benzothiazol-2-yl)-4,5-dimethylthiophene-2-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2nc3ccc(N)cc3s2)sc1C |
| InChI | InChI=1S/C14H13N3OS2/c1-7-5-12(19-8(7)2)13(18)17-14-16-10-4-3-9(15)6-11(10)20-14/h3-6H,15H2,1-2H3,(H,16,17,18) |
| InChIKey | AIBPBAUBGKIJQW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|