C14H11N3O3S — CID 107721354
N-(6-amino-1,3-benzothiazol-2-yl)-2,5-dihydroxybenzamide (PubChem CID 107721354) has the molecular formula C14H11N3O3S and a molecular weight of 301.33 g/mol. Its IUPAC name is N-(6-amino-1,3-benzothiazol-2-yl)-2,5-dihydroxybenzamide.
| Compound Name | N-(6-amino-1,3-benzothiazol-2-yl)-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107721354 |
| Molecular Formula | C14H11N3O3S |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | N-(6-amino-1,3-benzothiazol-2-yl)-2,5-dihydroxybenzamide |
| SMILES | Nc1ccc2nc(NC(=O)c3cc(O)ccc3O)sc2c1 |
| InChI | InChI=1S/C14H11N3O3S/c15-7-1-3-10-12(5-7)21-14(16-10)17-13(20)9-6-8(18)2-4-11(9)19/h1-6,18-19H,15H2,(H,16,17,20) |
| InChIKey | FTKFEGUAKTUFBR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 108.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|