C12H8BrN3OS2 — CID 107959275
N-(6-amino-1,3-benzothiazol-2-yl)-5-bromothiophene-3-carboxamide (PubChem CID 107959275) has the molecular formula C12H8BrN3OS2 and a molecular weight of 354.25 g/mol. Its IUPAC name is N-(6-amino-1,3-benzothiazol-2-yl)-5-bromothiophene-3-carboxamide.
| Compound Name | N-(6-amino-1,3-benzothiazol-2-yl)-5-bromothiophene-3-carboxamide |
|---|---|
| PubChem CID | 107959275 |
| Molecular Formula | C12H8BrN3OS2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 352.93 |
| IUPAC Name | N-(6-amino-1,3-benzothiazol-2-yl)-5-bromothiophene-3-carboxamide |
| SMILES | Nc1ccc2nc(NC(=O)c3csc(Br)c3)sc2c1 |
| InChI | InChI=1S/C12H8BrN3OS2/c13-10-3-6(5-18-10)11(17)16-12-15-8-2-1-7(14)4-9(8)19-12/h1-5H,14H2,(H,15,16,17) |
| InChIKey | PKJWCTDJNYKWCL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|