C14H9BrFN3OS — CID 114558355
N-(6-amino-1,3-benzothiazol-2-yl)-2-bromo-6-fluorobenzamide (PubChem CID 114558355) has the molecular formula C14H9BrFN3OS and a molecular weight of 366.22 g/mol. Its IUPAC name is N-(6-amino-1,3-benzothiazol-2-yl)-2-bromo-6-fluorobenzamide.
| Compound Name | N-(6-amino-1,3-benzothiazol-2-yl)-2-bromo-6-fluorobenzamide |
|---|---|
| PubChem CID | 114558355 |
| Molecular Formula | C14H9BrFN3OS |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 364.96 |
| IUPAC Name | N-(6-amino-1,3-benzothiazol-2-yl)-2-bromo-6-fluorobenzamide |
| SMILES | Nc1ccc2nc(NC(=O)c3c(F)cccc3Br)sc2c1 |
| InChI | InChI=1S/C14H9BrFN3OS/c15-8-2-1-3-9(16)12(8)13(20)19-14-18-10-5-4-7(17)6-11(10)21-14/h1-6H,17H2,(H,18,19,20) |
| InChIKey | YLVSRGGNDAXALB-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|