C12H8Br2N4OS — CID 134146043
N-(6-amino-1,3-benzothiazol-2-yl)-4,5-dibromo-1H-pyrrole-2-carboxamide (PubChem CID 134146043) has the molecular formula C12H8Br2N4OS and a molecular weight of 416.10 g/mol. Its IUPAC name is N-(6-amino-1,3-benzothiazol-2-yl)-4,5-dibromo-1H-pyrrole-2-carboxamide.
| Compound Name | N-(6-amino-1,3-benzothiazol-2-yl)-4,5-dibromo-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 134146043 |
| Molecular Formula | C12H8Br2N4OS |
| Molecular Weight | 416.10 g/mol |
| Exact Mass | 413.88 |
| IUPAC Name | N-(6-amino-1,3-benzothiazol-2-yl)-4,5-dibromo-1H-pyrrole-2-carboxamide |
| SMILES | Nc1ccc2nc(NC(=O)c3cc(Br)c(Br)[nH]3)sc2c1 |
| InChI | InChI=1S/C12H8Br2N4OS/c13-6-4-8(16-10(6)14)11(19)18-12-17-7-2-1-5(15)3-9(7)20-12/h1-4,16H,15H2,(H,17,18,19) |
| InChIKey | ANDKBRLNIKATCM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.10 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|