C19H19N3O3 — CID 42344151
(2S)-N-[1-(pyridine-3-carbonyl)-2,3-dihydroindol-6-yl]oxolane-2-carboxamide (PubChem CID 42344151) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is (2S)-N-[1-(pyridine-3-carbonyl)-2,3-dihydroindol-6-yl]oxolane-2-carboxamide.
| Compound Name | (2S)-N-[1-(pyridine-3-carbonyl)-2,3-dihydroindol-6-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 42344151 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | (2S)-N-[1-(pyridine-3-carbonyl)-2,3-dihydroindol-6-yl]oxolane-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)N(C(=O)c1cccnc1)CC2)[C@@H]1CCCO1 |
| InChI | InChI=1S/C19H19N3O3/c23-18(17-4-2-10-25-17)21-15-6-5-13-7-9-22(16(13)11-15)19(24)14-3-1-8-20-12-14/h1,3,5-6,8,11-12,17H,2,4,7,9-10H2,(H,21,23)/t17-/m0/s1 |
| InChIKey | LOEZQIUYEPYOOS-KRWDZBQOSA-N |
| XLogP | 2.40 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |