C19H22N4O2 — CID 110623609
1-butan-2-yl-3-[1-(pyridine-3-carbonyl)-2,3-dihydroindol-6-yl]urea (PubChem CID 110623609) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-butan-2-yl-3-[1-(pyridine-3-carbonyl)-2,3-dihydroindol-6-yl]urea.
| Compound Name | 1-butan-2-yl-3-[1-(pyridine-3-carbonyl)-2,3-dihydroindol-6-yl]urea |
|---|---|
| PubChem CID | 110623609 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 1-butan-2-yl-3-[1-(pyridine-3-carbonyl)-2,3-dihydroindol-6-yl]urea |
| SMILES | CCC(C)NC(=O)Nc1ccc2c(c1)N(C(=O)c1cccnc1)CC2 |
| InChI | InChI=1S/C19H22N4O2/c1-3-13(2)21-19(25)22-16-7-6-14-8-10-23(17(14)11-16)18(24)15-5-4-9-20-12-15/h4-7,9,11-13H,3,8,10H2,1-2H3,(H2,21,22,25) |
| InChIKey | IBZHZXYCVSNKMV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |