C22H19N3O2 — CID 46384404
1-(1-benzoyl-2,3-dihydroindol-6-yl)-3-phenylurea (PubChem CID 46384404) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-(1-benzoyl-2,3-dihydroindol-6-yl)-3-phenylurea.
| Compound Name | 1-(1-benzoyl-2,3-dihydroindol-6-yl)-3-phenylurea |
|---|---|
| PubChem CID | 46384404 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 1-(1-benzoyl-2,3-dihydroindol-6-yl)-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1ccc2c(c1)N(C(=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C22H19N3O2/c26-21(17-7-3-1-4-8-17)25-14-13-16-11-12-19(15-20(16)25)24-22(27)23-18-9-5-2-6-10-18/h1-12,15H,13-14H2,(H2,23,24,27) |
| InChIKey | XGABYFWAQDSGQV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |