C24H23N3O2 — CID 46384359
1-[1-(4-methylbenzoyl)-2,3-dihydroindol-6-yl]-3-(2-methylphenyl)urea (PubChem CID 46384359) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 1-[1-(4-methylbenzoyl)-2,3-dihydroindol-6-yl]-3-(2-methylphenyl)urea.
| Compound Name | 1-[1-(4-methylbenzoyl)-2,3-dihydroindol-6-yl]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 46384359 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1-[1-(4-methylbenzoyl)-2,3-dihydroindol-6-yl]-3-(2-methylphenyl)urea |
| SMILES | Cc1ccc(C(=O)N2CCc3ccc(NC(=O)Nc4ccccc4C)cc32)cc1 |
| InChI | InChI=1S/C24H23N3O2/c1-16-7-9-19(10-8-16)23(28)27-14-13-18-11-12-20(15-22(18)27)25-24(29)26-21-6-4-3-5-17(21)2/h3-12,15H,13-14H2,1-2H3,(H2,25,26,29) |
| InChIKey | QKXHXQCYPJFQPF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |