C24H22ClN3O4 — CID 46384423
1-(1-benzoyl-2,3-dihydroindol-6-yl)-3-(5-chloro-2,4-dimethoxyphenyl)urea (PubChem CID 46384423) has the molecular formula C24H22ClN3O4 and a molecular weight of 451.91 g/mol. Its IUPAC name is 1-(1-benzoyl-2,3-dihydroindol-6-yl)-3-(5-chloro-2,4-dimethoxyphenyl)urea.
| Compound Name | 1-(1-benzoyl-2,3-dihydroindol-6-yl)-3-(5-chloro-2,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 46384423 |
| Molecular Formula | C24H22ClN3O4 |
| Molecular Weight | 451.91 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 1-(1-benzoyl-2,3-dihydroindol-6-yl)-3-(5-chloro-2,4-dimethoxyphenyl)urea |
| SMILES | COc1cc(OC)c(NC(=O)Nc2ccc3c(c2)N(C(=O)c2ccccc2)CC3)cc1Cl |
| InChI | InChI=1S/C24H22ClN3O4/c1-31-21-14-22(32-2)19(13-18(21)25)27-24(30)26-17-9-8-15-10-11-28(20(15)12-17)23(29)16-6-4-3-5-7-16/h3-9,12-14H,10-11H2,1-2H3,(H2,26,27,30) |
| InChIKey | AGPMHKRWULTDAP-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.91 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |